840481-82-5 Usage
Description
Benzonitrile, 3-bromo-2-fluoro(9CI), is a chemical compound characterized by the molecular formula C7H3BrFN. It is a derivative of benzonitrile, distinguished by the presence of a bromine atom at the 3rd position and a fluorine atom at the 2nd position on the benzene ring. This unique substitution pattern endows the compound with distinct chemical and physical properties, which are advantageous in various applications within the pharmaceutical and chemical industries. Benzonitrile, 3-bromo-2-fluoro(9CI) serves as a versatile building block for the synthesis of other complex organic molecules.
Uses
Used in Pharmaceutical Industry:
Benzonitrile, 3-bromo-2-fluoro(9CI), is utilized as an intermediate in the synthesis of pharmaceutical compounds. Its specific substitution pattern allows for the development of new drugs with unique therapeutic properties. Benzonitrile, 3-bromo-2-fluoro(9CI)'s reactivity and structural features make it a valuable component in the creation of novel medicinal agents.
Used in Chemical Industry:
In the chemical industry, Benzonitrile, 3-bromo-2-fluoro(9CI), is employed as a building block for the synthesis of various organic compounds. Its unique substitution pattern on the benzene ring provides a foundation for the development of new chemical entities with specific applications in areas such as materials science, agrochemicals, and specialty chemicals.
Used in Research and Development:
Benzonitrile, 3-bromo-2-fluoro(9CI), is also used in research and development settings to explore its potential applications and properties. Scientists and researchers leverage the compound's unique characteristics to investigate its reactivity, stability, and interactions with other molecules, paving the way for new discoveries and innovations in the field of chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 840481-82-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,4,0,4,8 and 1 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 840481-82:
(8*8)+(7*4)+(6*0)+(5*4)+(4*8)+(3*1)+(2*8)+(1*2)=165
165 % 10 = 5
So 840481-82-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H3BrFN/c8-6-3-1-2-5(4-10)7(6)9/h1-3H
840481-82-5Relevant articles and documents
STK4 INHIBITORS FOR TREATMENT OF HEMATOLOGIC MALIGNANCIES
-
Paragraph 00753, (2017/01/09)
The application relates to compounds of Formula (I'): which modulate the activity of a kinase (e.g., STK4), a pharmaceutical composition comprising the compound, and a method of treating or preventing a disease or disorder associated with the modulation of a kinase, such as STK4.