85462-60-8 Usage
Uses
Used in Organic Synthesis:
4,5-DIFLUORO-2-METHYLINDOLE is used as a building block in organic synthesis for the creation of various biologically active molecules. Its unique structure allows for the development of new compounds with potential applications in different industries.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 4,5-DIFLUORO-2-METHYLINDOLE is utilized as a starting material for the synthesis of new drugs. Its potential pharmacological properties make it a valuable candidate for the development of treatments for various medical conditions.
Used as an Enzyme and Receptor Inhibitor:
4,5-DIFLUORO-2-METHYLINDOLE has been studied for its ability to act as an inhibitor of certain enzymes and receptors. This property can be harnessed in the development of drugs that target specific biological pathways, potentially leading to more effective treatments for diseases.
Used in Drug Development for Medical Conditions:
4,5-DIFLUORO-2-METHYLINDOLE has been investigated for its potential use in the development of new drugs for the treatment of various medical conditions. Its unique structure and pharmacological properties make it a promising candidate for further research and development in the medical field.
Check Digit Verification of cas no
The CAS Registry Mumber 85462-60-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,4,6 and 2 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 85462-60:
(7*8)+(6*5)+(5*4)+(4*6)+(3*2)+(2*6)+(1*0)=148
148 % 10 = 8
So 85462-60-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H7F2N/c1-5-4-6-8(12-5)3-2-7(10)9(6)11/h2-4,12H,1H3
