855198-37-7 Usage
Uses
Used in Pharmaceutical Industry:
2-Bromo-3-iodo-benzoic acid is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure with bromine and iodine substituents allows for the development of new drugs with specific therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical industry, 2-Bromo-3-iodo-benzoic acid is utilized as a building block for the synthesis of agrochemicals, such as pesticides and herbicides. Its presence in these compounds can enhance their effectiveness in controlling pests and weeds.
Used in Dye Industry:
2-Bromo-3-iodo-benzoic acid is employed in the dye industry for the production of various dyes. Its chemical properties contribute to the color and stability of the dyes, making them suitable for different applications, such as textiles and printing inks.
Used in Research and Development:
2-Bromo-3-iodo-benzoic acid serves as a valuable building block in organic chemistry research and development. Its unique structure allows chemists to explore new reactions and syntheses, leading to the discovery of novel compounds with potential applications in various fields.
Safety Precautions:
It is important to handle 2-Bromo-3-iodo-benzoic acid with care, as it may cause irritation to the skin, eyes, and respiratory system. Proper safety measures, such as wearing protective clothing and using appropriate ventilation, should be taken during its use and handling.
Check Digit Verification of cas no
The CAS Registry Mumber 855198-37-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,5,1,9 and 8 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 855198-37:
(8*8)+(7*5)+(6*5)+(5*1)+(4*9)+(3*8)+(2*3)+(1*7)=207
207 % 10 = 7
So 855198-37-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H4BrIO2/c8-6-4(7(10)11)2-1-3-5(6)9/h1-3H,(H,10,11)
