857429-79-9 Usage
General Description
2,5-Dibromo-3-pyridinol is a chemical compound with the molecular formula C5H3Br2NO. It is a synthetic intermediate used in the manufacture of pharmaceuticals, agrochemicals, and other organic compounds. 2,5-DIBROMO-3-PYRIDINOL has two bromine atoms attached to a pyridinol ring, which gives it significant chemical reactivity. The compound is commonly used as a building block in the synthesis of biologically active molecules, such as herbicides and fungicides, due to its ability to bond with other molecules and alter their chemical properties. Additionally, 2,5-Dibromo-3-pyridinol has been studied for its potential as an antifungal and antimicrobial agent, making it a valuable compound in the field of medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 857429-79-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,7,4,2 and 9 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 857429-79:
(8*8)+(7*5)+(6*7)+(5*4)+(4*2)+(3*9)+(2*7)+(1*9)=219
219 % 10 = 9
So 857429-79-9 is a valid CAS Registry Number.
InChI:InChI=1S/C5H3Br2NO/c6-3-1-4(9)5(7)8-2-3/h1-2,9H
