857429-79-9 Usage
Uses
Used in Pharmaceutical Industry:
2,5-DIBROMO-3-PYRIDINOL is used as a synthetic intermediate for the development of pharmaceuticals. Its reactivity and ability to bond with other molecules make it instrumental in the creation of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
2,5-DIBROMO-3-PYRIDINOL is used as a building block in the synthesis of agrochemicals, such as herbicides and fungicides. Its capacity to alter the chemical properties of other molecules contributes to the development of effective crop protection agents.
Used in Medicinal Chemistry:
2,5-DIBROMO-3-PYRIDINOL is used as a potential antifungal and antimicrobial agent. Its chemical properties have been studied for their ability to combat various fungal and microbial infections, making it a valuable compound in the field of medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 857429-79-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,7,4,2 and 9 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 857429-79:
(8*8)+(7*5)+(6*7)+(5*4)+(4*2)+(3*9)+(2*7)+(1*9)=219
219 % 10 = 9
So 857429-79-9 is a valid CAS Registry Number.
InChI:InChI=1S/C5H3Br2NO/c6-3-1-4(9)5(7)8-2-3/h1-2,9H
