86-40-8 Usage
Description
3,6-DIAMINO-10-METHYLACRIDINIUM CHLORIDE, also known as the 10-methochloride salt of 3,6-diaminoacridine, is a chemical compound that belongs to the acridine family. It is characterized by the presence of two amino groups at the 3 and 6 positions and a methyl group at the 10 position. 3,6-DIAMINO-10-METHYLACRIDINIUM CHLORIDE is known to form a mixture with 3,6-diaminoacridine (proflavine), which is referred to as acriflavine or neutral acriflavine.
Uses
Used in Pharmaceutical Industry:
3,6-DIAMINO-10-METHYLACRIDINIUM CHLORIDE is used as an active pharmaceutical ingredient for the development of drugs targeting various diseases and conditions. Its unique chemical structure allows it to interact with biological molecules, making it a promising candidate for medicinal applications.
Used in Research and Development:
In the field of scientific research, 3,6-DIAMINO-10-METHYLACRIDINIUM CHLORIDE serves as a valuable compound for studying the properties and mechanisms of acridine-based compounds. It can be used to investigate the interactions between these molecules and biological targets, contributing to the advancement of knowledge in medicinal chemistry and related fields.
Used in Chemical Synthesis:
3,6-DIAMINO-10-METHYLACRIDINIUM CHLORIDE can be employed as a starting material or intermediate in the synthesis of other acridine-based compounds. Its versatile structure makes it suitable for various chemical reactions, enabling the production of a wide range of derivatives with potential applications in different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 86-40-8 includes 5 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 2 digits, 8 and 6 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 86-40:
(4*8)+(3*6)+(2*4)+(1*0)=58
58 % 10 = 8
So 86-40-8 is a valid CAS Registry Number.
InChI:InChI=1/C14H13N3.ClH/c1-17-13-6-5-10(15)7-9(13)8-11-12(16)3-2-4-14(11)17;/h2-8,16H,15H2,1H3;1H