867130-58-3 Usage
General Description
6-oxo-1,6-dihydropyridazine-4-carboxylic acid is a chemical compound with a molecular structure consisting of a six-membered heterocyclic ring containing a nitrogen atom and a carboxylic acid group. It is a derivative of pyridazine and is classified as a dihydropyridazine due to the presence of a double bond between two carbon atoms in the ring. 6-oxo-1,6-dihydropyridazine-4-carboxylicacid is of interest in medicinal chemistry and organic synthesis due to its potential as a building block for the synthesis of pharmaceuticals and functional materials. Its unique structure and reactive functional groups make it a valuable chemical intermediate for the production of various organic compounds with diverse applications in the fields of pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 867130-58-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,6,7,1,3 and 0 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 867130-58:
(8*8)+(7*6)+(6*7)+(5*1)+(4*3)+(3*0)+(2*5)+(1*8)=183
183 % 10 = 3
So 867130-58-3 is a valid CAS Registry Number.
InChI:InChI=1/C5H4N2O3/c8-4-1-3(5(9)10)2-6-7-4/h1-2H,(H,7,8)(H,9,10)
