873376-29-5 Usage
Uses
Used in Pharmaceutical Industry:
2-METHYL-3-PYRROLIDIN-1-YL-PROPAN-1-OL is used as a raw material for the synthesis of pharmaceuticals, contributing to the development of new drugs and medications. Its unique chemical properties allow it to be a key component in the formulation of various therapeutic agents.
Used in Agrochemical Industry:
In the agrochemical sector, 2-METHYL-3-PYRROLIDIN-1-YL-PROPAN-1-OL serves as a raw material in the production of agrochemicals, such as pesticides and herbicides. Its role in these applications helps to enhance crop protection and improve agricultural productivity.
Used as a Solvent:
2-METHYL-3-PYRROLIDIN-1-YL-PROPAN-1-OL is utilized as a solvent in various chemical processes due to its ability to dissolve a wide range of substances. Its solvent properties make it suitable for use in industries that require efficient and effective dissolution of materials.
Used as an Intermediate in Chemical Manufacturing:
As an intermediate, 2-METHYL-3-PYRROLIDIN-1-YL-PROPAN-1-OL plays a crucial role in the manufacturing of other chemicals. Its involvement in chemical reactions helps to produce a variety of end products that cater to different industries and applications.
Used in Organic Synthesis:
2-METHYL-3-PYRROLIDIN-1-YL-PROPAN-1-OL has potential applications in the field of organic synthesis, where it can be used as a reagent in various chemical reactions. Its participation in these reactions contributes to the creation of new organic compounds with diverse properties and uses.
Check Digit Verification of cas no
The CAS Registry Mumber 873376-29-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,3,3,7 and 6 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 873376-29:
(8*8)+(7*7)+(6*3)+(5*3)+(4*7)+(3*6)+(2*2)+(1*9)=205
205 % 10 = 5
So 873376-29-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H17NO/c1-8(7-10)6-9-4-2-3-5-9/h8,10H,2-7H2,1H3
