875-94-5 Usage
Uses
Used in Organic Synthesis:
4-Carboxylbenzocyclobutene is utilized as a key building block for the synthesis of various organic compounds and materials. Its reactivity and the presence of the carboxyl group make it a versatile component in creating new chemical entities with potential applications across different industries.
Used in Materials Science:
In the field of materials science, 4-Carboxylbenzocyclobutene is employed as a precursor for developing novel materials with specific properties. Its unique structure allows for the engineering of materials with tailored characteristics, such as improved stability, reactivity, or selectivity, which can be advantageous in numerous applications.
Used in Pharmaceutical Industry:
4-Carboxylbenzocyclobutene is used as a starting material for the development of pharmaceutical compounds. Its chemical properties can be harnessed to create new drug candidates with potential therapeutic effects, contributing to the advancement of medicinal chemistry.
Used in Chemical Research:
4-Carboxylbenzocyclobutene serves as an interesting target for research in organic chemistry. Its unique structure and reactivity provide opportunities for exploring new reaction pathways, understanding fundamental chemical processes, and potentially discovering new applications in various chemical domains.
Check Digit Verification of cas no
The CAS Registry Mumber 875-94-5 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 8,7 and 5 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 875-94:
(5*8)+(4*7)+(3*5)+(2*9)+(1*4)=105
105 % 10 = 5
So 875-94-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H8O2/c10-9(11)8-4-2-6-1-3-7(6)5-8/h2,4-5H,1,3H2,(H,10,11)
