876717-53-2 Usage
General Description
2-Methylamino-isonicotinic acid, also known as 2-MAIA, is a chemical compound that belongs to the class of aminonicotic acids. It is a derivative of isonicotinic acid and contains a methylamino group at the 2-position. 2-MAIA is often used as a building block in the synthesis of various pharmaceuticals, agrochemicals, and other organic compounds. It exhibits potential pharmacological and biological activities, making it a valuable intermediate in drug discovery and development. Additionally, its unique structure and properties make it an important target for research and chemical synthesis in the field of medicinal chemistry and organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 876717-53-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,6,7,1 and 7 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 876717-53:
(8*8)+(7*7)+(6*6)+(5*7)+(4*1)+(3*7)+(2*5)+(1*3)=222
222 % 10 = 2
So 876717-53-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N2O2/c1-8-6-4-5(7(10)11)2-3-9-6/h2-4H,1H3,(H,8,9)(H,10,11)