89124-90-3 Usage
Uses
Used in Pharmaceutical Industry:
3-Amino-5-ethoxy-1,2,4-thiadiazole is utilized as a building block in the synthesis of various pharmaceuticals due to its unique chemical structure and properties. Its incorporation into drug molecules can enhance their therapeutic effects and target specific biological pathways.
3-Amino-5-ethoxy-1,2,4-thiadiazole is used as an antimicrobial agent for its ability to inhibit the growth of various microorganisms, making it a valuable component in the development of new antibiotics and antifungal medications.
Additionally, it is used as an anti-tumor agent, leveraging its anti-tumor properties to target and inhibit the growth of cancer cells, offering a potential therapeutic approach for cancer treatment.
Used in Agrochemical Industry:
In the agrochemical sector, 3-Amino-5-ethoxy-1,2,4-thiadiazole is employed as a key component in the development of pesticides and herbicides. Its incorporation into these products can improve their effectiveness in controlling pests and unwanted plant growth, contributing to increased crop yields and protection.
3-Amino-5-ethoxy-1,2,4-thiadiazole is also used as a building block in the synthesis of agrochemicals, allowing for the creation of novel compounds with enhanced properties, such as increased stability, selectivity, and reduced environmental impact.
Check Digit Verification of cas no
The CAS Registry Mumber 89124-90-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,1,2 and 4 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 89124-90:
(7*8)+(6*9)+(5*1)+(4*2)+(3*4)+(2*9)+(1*0)=153
153 % 10 = 3
So 89124-90-3 is a valid CAS Registry Number.
InChI:InChI=1/C4H7N3OS/c1-2-8-4-6-3(5)7-9-4/h2H2,1H3,(H2,5,7)
