892874-34-9 Usage
Uses
Used in Organic Synthesis:
7-Bromoquinoline-3-carboxylic acid is used as a key intermediate in the synthesis of various organic molecules. Its unique structure allows for further functionalization and modification, making it a versatile component in the creation of complex organic compounds.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 7-Bromoquinoline-3-carboxylic acid is utilized as a starting material for the development of new pharmaceutical agents. Its biological activity and structural features make it a promising candidate for the design of drugs targeting specific diseases and conditions.
Used in Antimicrobial Applications:
7-Bromoquinoline-3-carboxylic acid is used as an antimicrobial agent for its ability to inhibit the growth of various microorganisms. Its effectiveness against bacteria, fungi, and other pathogens makes it a valuable component in the development of new antimicrobial drugs and treatments.
Used in Antiparasitic Applications:
7-BROMOQUINOLINE-3-CARBOXYLIC ACID is also employed as an antiparasitic agent, targeting and eliminating parasites that cause diseases in humans and animals. Its potential use in antiparasitic medications contributes to the development of treatments for parasitic infections.
Used as an Enzyme Inhibitor:
7-Bromoquinoline-3-carboxylic acid has shown potential as an inhibitor of certain enzymes, which can be crucial in the regulation of biological processes and the treatment of enzyme-related diseases. Its ability to modulate enzyme activity makes it a candidate for the development of enzyme-targeting therapeutics.
Used in Pharmaceutical Compound Preparation:
As a building block for the preparation of pharmaceutical compounds, 7-Bromoquinoline-3-carboxylic acid plays a significant role in the synthesis of various drugs. Its incorporation into drug molecules can enhance their efficacy, selectivity, and pharmacokinetic properties, leading to improved therapeutic outcomes.
Check Digit Verification of cas no
The CAS Registry Mumber 892874-34-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,2,8,7 and 4 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 892874-34:
(8*8)+(7*9)+(6*2)+(5*8)+(4*7)+(3*4)+(2*3)+(1*4)=229
229 % 10 = 9
So 892874-34-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H6BrNO2/c11-8-2-1-6-3-7(10(13)14)5-12-9(6)4-8/h1-5H,(H,13,14)
892874-34-9Relevant academic research and scientific papers
OXADIAZOLE INHIBITORS OF HIPK2 FOR TREATING KIDNEY FIBROSIS
-
, (2018/07/31)
Compounds that are selective inhibitors of Smad3 activation are disclosed. The compounds have the structure (I) in which Z is an oxadiazole. The compounds disclosed are useful in treatment of fibrotic disease, particularly renal fibrosis, and similar dise
FATTY ACID SYNTHASE INHIBITORS
-
Page/Page column 60, (2014/01/07)
Disclosed are compounds having Formula (I), wherein R1, R2, R3, R4, R5, R6, R7, R8, R9, Y, m, and n are defined herein and methods of using the same.
