945655-38-9 Usage
Uses
Used in Medicinal Chemistry:
ETHYL 6-AMINO-2-PHENYL-1H-INDOLE-3-CARBOXYLATE is used as a pharmaceutical candidate for the development of new drugs due to its pharmacological properties. Its unique structure allows it to interact with biological targets, potentially leading to the discovery of novel therapeutic agents.
Used in Drug Discovery:
In the field of drug discovery, ETHYL 6-AMINO-2-PHENYL-1H-INDOLE-3-CARBOXYLATE serves as a valuable starting point for the design and synthesis of new compounds with potential therapeutic effects. Its chemical properties and structural features make it a promising candidate for further optimization and modification to enhance its pharmacological activity.
Used in Organic Synthesis:
ETHYL 6-AMINO-2-PHENYL-1H-INDOLE-3-CARBOXYLATE is used as a building block in the synthesis of various organic molecules. Its functional groups and aromatic ring provide opportunities for chemical reactions and modifications, enabling the creation of a wide range of compounds with diverse applications in chemistry and biology.
Used in Chemical Biology Research:
In chemical biology research, ETHYL 6-AMINO-2-PHENYL-1H-INDOLE-3-CARBOXYLATE can be employed as a tool compound to study the interactions between small molecules and biological systems. Its unique structure and properties make it suitable for probing the mechanisms of biological processes and identifying potential targets for therapeutic intervention.
Check Digit Verification of cas no
The CAS Registry Mumber 945655-38-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,5,6,5 and 5 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 945655-38:
(8*9)+(7*4)+(6*5)+(5*6)+(4*5)+(3*5)+(2*3)+(1*8)=209
209 % 10 = 9
So 945655-38-9 is a valid CAS Registry Number.
InChI:InChI=1/C17H16N2O2/c1-2-21-17(20)15-13-9-8-12(18)10-14(13)19-16(15)11-6-4-3-5-7-11/h3-10,19H,2,18H2,1H3
945655-38-9Relevant articles and documents
A practical synthesis of 2-aryl-indole-6-carboxylic acids
Gallou, Fabrice,Yee, Nathan,Qiu, Fenghe,Senanayake, Chris,Linz, Guenter,Schnaubelt, Juergen,Soyka, Rainer
, p. 883 - 885 (2007/10/03)
A practical synthesis of 2-aryl-indole-6-carboxylic acids was developed via a sequence consisting of SNAr reaction, reductive cyclization, hydrolysis and decarboxylation. This process is efficient in terms of operational simplicity, cost effectiveness and is amenable to large scale production.
