945655-38-9 Usage
General Description
ETHYL 6-AMINO-2-PHENYL-1H-INDOLE-3-CARBOXYLATE is a chemical compound with the molecular formula C18H17N3O2. It is a derivative of indole, a heterocyclic organic compound. ETHYL 6-AMINO-2-PHENYL-1H-INDOLE-3-CARBOXYLATE contains an ethyl ester group, an amino group and a carboxylate group, as well as a phenyl ring. It has potential applications in medicinal chemistry and drug discovery, as it exhibits pharmacological properties that may be useful in the development of new pharmaceuticals. Additionally, it can be used as a building block in the synthesis of various organic molecules. Overall, ETHYL 6-AMINO-2-PHENYL-1H-INDOLE-3-CARBOXYLATE is a versatile compound with potential applications in various fields of chemistry and biology.
Check Digit Verification of cas no
The CAS Registry Mumber 945655-38-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,5,6,5 and 5 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 945655-38:
(8*9)+(7*4)+(6*5)+(5*6)+(4*5)+(3*5)+(2*3)+(1*8)=209
209 % 10 = 9
So 945655-38-9 is a valid CAS Registry Number.
InChI:InChI=1/C17H16N2O2/c1-2-21-17(20)15-13-9-8-12(18)10-14(13)19-16(15)11-6-4-3-5-7-11/h3-10,19H,2,18H2,1H3
945655-38-9Relevant articles and documents
A practical synthesis of 2-aryl-indole-6-carboxylic acids
Gallou, Fabrice,Yee, Nathan,Qiu, Fenghe,Senanayake, Chris,Linz, Guenter,Schnaubelt, Juergen,Soyka, Rainer
, p. 883 - 885 (2007/10/03)
A practical synthesis of 2-aryl-indole-6-carboxylic acids was developed via a sequence consisting of SNAr reaction, reductive cyclization, hydrolysis and decarboxylation. This process is efficient in terms of operational simplicity, cost effectiveness and is amenable to large scale production.
