947-88-6 Usage
Uses
Used in Medicinal Chemistry and Pharmaceutical Research:
3-(2-Pyridyl)-1,2,3-triazolo(1,5-a)pyridine is utilized as a key building block in the synthesis of novel drugs and biologically active molecules. Its heterocyclic nature allows for the development of compounds with potential therapeutic applications, including those targeting specific diseases or conditions.
Used in Materials Science:
In the field of materials science, 3-(2-Pyridyl)-1,2,3-triazolo(1,5-a)pyridine is employed for its electronic and optical properties, which can be harnessed to create advanced materials with unique functionalities. These materials may find applications in various industries, such as electronics, photonics, and energy storage.
Used in Organic Electronics:
3-(2-Pyridyl)-1,2,3-triazolo(1,5-a)pyridine is used as a component in the development of organic electronic devices, such as organic light-emitting diodes (OLEDs), organic solar cells, and organic field-effect transistors (OFETs). Its electronic properties contribute to the performance and efficiency of these devices.
Further research into the potential uses and properties of 3-(2-Pyridyl)-1,2,3-triazolo(1,5-a)pyridine is essential to unlock its full potential and contribute to the development of new drugs, materials, and technologies with significant practical applications across various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 947-88-6 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 9,4 and 7 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 947-88:
(5*9)+(4*4)+(3*7)+(2*8)+(1*8)=106
106 % 10 = 6
So 947-88-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H8N4/c1-3-7-12-9(5-1)11-10-6-2-4-8-15(10)14-13-11/h1-8H
947-88-6Relevant academic research and scientific papers
Synthesis of new fluorescent amino acids with a triazolopyridine core: Diacid sensors
Chiassai,Ballesteros-Garrido,Ballesteros,Abarca
, p. 14597 - 14601 (2018/08/28)
A new family of amino acid containing pyridine-triazolopyridine cores has been prepared by means of a copper catalysed reaction. These compounds exhibit an intense emission that has been employed to sense the distance between two carboxylic acids in a linear molecule, from oxalic to glutaric acids.
