94944-63-5 Usage
Description
(S)-4,5-ISOPROPYLIDENE-1-PENTYLAMINE, with the molecular formula C10H23N, is a chiral amine derivative featuring a pentylamine group and an isopropylidene group. As a chiral molecule, it possesses non-superimposable mirror images, known as enantiomers. (S)-4,5-ISOPROPYLIDENE-1-PENTYLAMINE is predominantly utilized as a building block in the synthesis of pharmaceuticals and biologically active compounds, making it a valuable asset in medicinal chemistry and drug development.
Uses
Used in Pharmaceutical Synthesis:
(S)-4,5-ISOPROPYLIDENE-1-PENTYLAMINE is used as a key building block for the creation of various pharmaceuticals and biologically active compounds. Its unique structural features and chiral nature contribute to its significance in this application, allowing for the development of novel and effective medications.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, (S)-4,5-ISOPROPYLIDENE-1-PENTYLAMINE serves as an essential component in the design and synthesis of new drugs. Its versatility and the potential for asymmetric synthesis make it a preferred choice for researchers aiming to produce single enantiomer products, which can be crucial for the desired therapeutic effects and safety profiles of the resulting compounds.
Used in Drug Development:
(S)-4,5-ISOPROPYLIDENE-1-PENTYLAMINE plays a vital role in drug development, particularly in the synthesis of enantiomerically pure compounds. Its chiral nature is advantageous for the production of drugs with improved efficacy and reduced side effects, as the specific enantiomer can be targeted to interact with biological targets more selectively.
Used in Asymmetric Synthesis:
As a chiral molecule, (S)-4,5-ISOPROPYLIDENE-1-PENTYLAMINE is used in asymmetric synthesis to produce single enantiomer products. This application is particularly important in the pharmaceutical industry, as the desired biological activity and safety of a drug are often associated with a specific enantiomer. The ability to control the production of a single enantiomer can lead to more effective and safer medications.
Check Digit Verification of cas no
The CAS Registry Mumber 94944-63-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,4,9,4 and 4 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 94944-63:
(7*9)+(6*4)+(5*9)+(4*4)+(3*4)+(2*6)+(1*3)=175
175 % 10 = 5
So 94944-63-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H17NO2/c1-8(2)10-6-7(11-8)4-3-5-9/h7H,3-6,9H2,1-2H3/t7-/m0/s1