959617-74-4 Usage
Uses
Used in Pharmaceutical Industry:
3-Fluoro-1,5-naphthyridine is used as a key intermediate for the development of novel pharmaceutical compounds. Its unique structure and properties make it a promising candidate for the synthesis of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
3-Fluoro-1,5-naphthyridine is also utilized as a building block in the synthesis of agrochemical products. Its incorporation into these compounds can lead to the development of new pesticides or herbicides with improved efficacy and selectivity.
Used in Organic Chemistry:
3-Fluoro-1,5-naphthyridine may have uses as an intermediate in the production of other organic compounds. Its reactivity and structural features can be exploited in various organic synthesis processes to generate a range of valuable chemical products.
Check Digit Verification of cas no
The CAS Registry Mumber 959617-74-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,5,9,6,1 and 7 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 959617-74:
(8*9)+(7*5)+(6*9)+(5*6)+(4*1)+(3*7)+(2*7)+(1*4)=234
234 % 10 = 4
So 959617-74-4 is a valid CAS Registry Number.
InChI:InChI=1S/C8H5FN2/c9-6-4-8-7(11-5-6)2-1-3-10-8/h1-5H
959617-74-4Relevant academic research and scientific papers
NOVEL HETEROCYCLIC COMPOUND OR SALT THEREOF AND INTERMEDIATE THEREOF
-
, (2009/03/07)
Disclosed is a compound represented by the general formula: [wherein R1 represents an aryl or heterocyclic group which may be substituted or the like; X1 represents a C2-C4 alkylene group or the like; X2, X3 and X5 independently represent NH, a bond or the like; X4 represents a lower alkylene group, a bond or the like; Y1 represents a bivalent alicyclic hydrocarbon residue which may be substituted or a bivalent alicyclic amine residue which may be substituted; and Z1, Z2, Z3, Z4, Z5 and Z6 independently represent a nitrogen atom, a group represented by the formula: CH, or the like, provided that at least one of Z3, Z4, Z5 and Z6 represents a nitrogen atom] or a salt thereof, which is useful as an antibacterial agent.
