959958-25-9 Usage
Uses
Used in Pharmaceutical Synthesis:
5-Bromo-6-chloro-pyridine-2-carboxylic acid is utilized as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the creation of new drug candidates with potential therapeutic applications, making it an essential component in drug discovery processes.
Used in Agrochemical Production:
In the agrochemical industry, 5-Bromo-6-chloro-pyridine-2-carboxylic acid serves as a crucial intermediate for the development of new agrochemicals. Its incorporation into these products can lead to enhanced crop protection and management solutions.
Used as an Intermediate in Organic Chemistry:
5-Bromo-6-chloro-pyridine-2-carboxylic acid is also employed as an intermediate in the production of other organic compounds. Its functional groups and reactivity make it suitable for use in a wide range of organic synthesis processes, contributing to the creation of diverse chemical products.
Used in Biologically Active Molecule Synthesis:
Due to its structural features, 5-Bromo-6-chloro-pyridine-2-carboxylic acid is a building block in the synthesis of biologically active molecules. Its presence in these molecules can lead to the development of new compounds with significant biological activity, further expanding its applications in the field of medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 959958-25-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,5,9,9,5 and 8 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 959958-25:
(8*9)+(7*5)+(6*9)+(5*9)+(4*5)+(3*8)+(2*2)+(1*5)=259
259 % 10 = 9
So 959958-25-9 is a valid CAS Registry Number.
InChI:InChI=1S/C6H3BrClNO2/c7-3-1-2-4(6(10)11)9-5(3)8/h1-2H,(H,10,11)
959958-25-9Relevant academic research and scientific papers
AROMATIC RING COMPOUND
-
Paragraph 0269, (2015/01/18)
Provided is an aromatic ring compound having a GPR40 agonist activity. A compound represented by the formula (I): wherein each symbol is as described in the DESCRIPTION, or a salt thereof has a GPR40 agonist activity, and is useful as an agent for the prophylaxis or treatment of diabetes and the like.
