97096-16-7 Usage
Uses
Since the provided materials do not specify the uses of 1,4-DIOXA-SPIRO[4.5]DEC-8-YLAMINE, it is not possible to list its applications based on the given information. However, given that it is an amine, it can be inferred that it may have potential applications in the production of pharmaceuticals, polymers, or other chemical processes. Further research and information would be required to confirm its specific uses in different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 97096-16-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,7,0,9 and 6 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 97096-16:
(7*9)+(6*7)+(5*0)+(4*9)+(3*6)+(2*1)+(1*6)=167
167 % 10 = 7
So 97096-16-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H15NO2/c9-7-1-3-8(4-2-7)10-5-6-11-8/h7H,1-6,9H2