98027-52-2 Usage
Uses
Used in Pharmaceutical Research and Development:
1-Acetyl-4-iodo-1H-pyrazole is used as a key intermediate in the synthesis of biologically active molecules and pharmaceutical drugs. Its unique structure and functional groups make it a valuable building block for the development of new therapeutic agents.
Used in Synthesis of Biologically Active Molecules:
1-Acetyl-4-iodo-1H-pyrazole is used as a precursor in the synthesis of various biologically active molecules. Its acetyl and iodine substituents can be further modified or functionalized to create novel compounds with potential therapeutic properties.
Used in Drug Discovery:
1-Acetyl-4-iodo-1H-pyrazole is used as a starting material in drug discovery programs. Its unique chemical properties and structural features make it a promising candidate for the development of new drugs with improved efficacy and selectivity.
Used in Chemical Synthesis Processes:
1-Acetyl-4-iodo-1H-pyrazole is used as a versatile reagent in various chemical synthesis processes. Its acetyl and iodine groups can participate in a range of chemical reactions, enabling the formation of diverse chemical products.
Used in Development of New Materials:
1-Acetyl-4-iodo-1H-pyrazole may have potential applications in the development of new materials, such as advanced pharmaceutical formulations, imaging agents, or other specialty chemicals. Its unique properties and reactivity can contribute to the creation of innovative materials with specific functions or properties.
Check Digit Verification of cas no
The CAS Registry Mumber 98027-52-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,8,0,2 and 7 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 98027-52:
(7*9)+(6*8)+(5*0)+(4*2)+(3*7)+(2*5)+(1*2)=152
152 % 10 = 2
So 98027-52-2 is a valid CAS Registry Number.
InChI:InChI=1/C5H5IN2O/c1-4(9)8-3-5(6)2-7-8/h2-3H,1H3
98027-52-2Relevant academic research and scientific papers
Histone Deacetylase Inhibitors
-
Paragraph 0479, (2013/12/04)
This invention relates to generally inhibiting histone deacetylase (“HDAC”) enzymes (e.g., HDAC1, HDAC2, and HDAC3).
HISTONE DEACETYLASE INHIBITORS
-
Page/Page column 107, (2012/09/21)
This invention relates to generally inhibiting histone deacetylase (HDAC) enzymes (e.g., HDAC1, HDAC2, and HDAC3).
