98142-36-0 Usage
Uses
Used in Pharmaceutical Industry:
2,4-Dichloro-5,6,7,8-tetrahydropteridine is used as a potential drug candidate for the development of new treatments targeting conditions related to biopterin metabolism and neurotransmitter synthesis. Its unique chemical properties and potential biological activities make it a valuable asset in the creation of innovative therapeutics.
Used in Research Applications:
In the field of biological research, 2,4-Dichloro-5,6,7,8-tetrahydropteridine serves as a valuable tool for studying the role of pteridine derivatives in biological systems. Its specific chemical properties allow researchers to explore the mechanisms of action and potential interactions with other biomolecules, contributing to a deeper understanding of pteridine-related processes and their implications in health and disease.
Check Digit Verification of cas no
The CAS Registry Mumber 98142-36-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,8,1,4 and 2 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 98142-36:
(7*9)+(6*8)+(5*1)+(4*4)+(3*2)+(2*3)+(1*6)=150
150 % 10 = 0
So 98142-36-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H6Cl2N4/c7-4-3-5(10-2-1-9-3)12-6(8)11-4/h9H,1-2H2,(H,10,11,12)
