98591-49-2 Usage
Uses
Used in Pharmaceutical Industry:
3,5-DIBROMO-1H-INDOLE-2-CARBOXYLIC ACID is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure and functional groups make it a promising candidate for the development of new drugs with potential therapeutic applications.
Used in Organic Synthesis:
In the field of organic synthesis, 3,5-DIBROMO-1H-INDOLE-2-CARBOXYLIC ACID is utilized as a key building block for the creation of complex organic molecules. Its reactivity and structural features facilitate the formation of diverse chemical entities, contributing to the advancement of chemical research and the discovery of novel compounds with potential applications.
Used in Medicinal Chemistry:
3,5-DIBROMO-1H-INDOLE-2-CARBOXYLIC ACID is employed in medicinal chemistry as a precursor for the design and synthesis of bioactive molecules. Its potential pharmacological activities and molecular properties make it a valuable component in the development of new therapeutic agents, particularly in the search for treatments for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 98591-49-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,8,5,9 and 1 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 98591-49:
(7*9)+(6*8)+(5*5)+(4*9)+(3*1)+(2*4)+(1*9)=192
192 % 10 = 2
So 98591-49-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H5Br2NO2/c10-4-1-2-6-5(3-4)7(11)8(12-6)9(13)14/h1-3,12H,(H,13,14)
