The 2-Naphthalenecarboximidamide,N-hydroxy-, with the CAS registry number 64893-54-5, is also known as Naphthalene-2-acetamide oxime. This chemical's molecular formula is C₁₁H₁₀N₂O and molecular weight is 186.2099. Its systematic name is called N'-hydroxynaphthalene-2-carboximidamide. 

Physical properties of 2-Naphthalenecarboximidamide,N-hydroxy-: (1)ACD/LogP: 2.38; (2)ACD/LogD (pH 5.5): 2.24; (3)ACD/LogD (pH 7.4): 2.38; (4)ACD/BCF (pH 5.5): 27.5; (5)ACD/BCF (pH 7.4): 37.67; (6)ACD/KOC (pH 5.5): 340.78; (7)ACD/KOC (pH 7.4): 466.76; (8)#H bond acceptors: 3; (9)#H bond donors: 3; (10)#Freely Rotating Bonds: 2; (11)Index of Refraction: 1.631; (12)Molar Refractivity: 53.96 cm³; (13)Molar Volume: 151.3 cm³; (14)Surface Tension: 49.7 dyne/cm; (15)Density: 1.23 g/cm³; (16)Flash Point: 206 °C; (17)Enthalpy of Vaporization: 70.67 kJ/mol; (18)Boiling Point: 417 °C at 760 mmHg; (19)Vapour Pressure: 1.06E-07 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: ON=C(N)c2ccc1c(cccc1)c2
(2)InChI: InChI=1/C11H10N2O/c12-11(13-14)10-6-5-8-3-1-2-4-9(8)7-10/h1-7,14H,(H2,12,13)
(3)InChIKey: UHJICFSTOCFOND-UHFFFAOYAG