The Ethanesulfonic acid, 2, 2'-dithiobis-, with the CAS registry number of 45127-11-5, is also known as 2, 2'-Dithiodiethanesulfonic acid. This chemical's molecular formula is C₄H₁₀O₆S₄ and molecular weight is 282.3786. What's more, its IUPAC name is 2-(2-Sulfoethyldisulfanyl)ethanesulfonic acid.

Physical properties about Ethanesulfonic acid, 2, 2'-dithiobis- are: (1)ACD/LogP: -1.83; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -6.33; (4)ACD/LogD (pH 7.4): -6.33; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 6; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 7; (12)Polar Surface Area: 154.1 Å²; (13)Index of Refraction: 1.637; (14)Molar Refractivity: 57.3 cm³; (15)Molar Volume: 159.5 cm³; (16)Surface Tension: 90.6 dyne/cm; (17)Density: 1.769 g/cm³.

You can still convert the following datas into molecular structure:
(1) SMILES: O=S(=O)(O)CCSSCCS(=O)(=O)O
(2) InChI: InChI=1/C4H10O6S4/c5-13(6,7)3-1-11-12-2-4-14(8,9)10/h1-4H2,(H,5,6,7)(H,8,9,10)
(3) InChIKey: BYUKOOOZTSTOOH-UHFFFAOYAE