The Oxetane,3,3-bis(iodomethyl)-, with the CAS registry number 2402-82-6, is also known as 3,3-Di(iodomethyl)oxetane. This chemical's molecular formula is C₅H₈I₂O and molecular weight is 337.92536. Its IUPAC name is called 3,3-bis(iodomethyl)oxetane. This chemical's classification code is Drug / Therapeutic Agent.

Physical properties of Oxetane,3,3-bis(iodomethyl)-: (1)ACD/LogP: 2.18; (2)ACD/LogD (pH 5.5): 2.18; (3)ACD/LogD (pH 7.4): 2.18; (4)ACD/BCF (pH 5.5): 26.8; (5)ACD/BCF (pH 7.4): 26.8; (6)ACD/KOC (pH 5.5): 366.36; (7)ACD/KOC (pH 7.4): 366.36; (8)#H bond acceptors: 1; (9)#Freely Rotating Bonds: 2; (10)Index of Refraction: 1.642; (11)Molar Refractivity: 50.67 cm³; (12)Molar Volume: 140.2 cm³; (13)Surface Tension: 57.2 dyne/cm; (14)Density: 2.409 g/cm³; (15)Flash Point: 131.2 °C; (16)Enthalpy of Vaporization: 51.16 kJ/mol; (17)Boiling Point: 293.4 °C at 760 mmHg; (18)Vapour Pressure: 0.00303 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1C(CO1)(CI)CI
(2)InChI: InChI=1S/C5H8I2O/c6-1-5(2-7)3-8-4-5/h1-4H2
(3)InChIKey: JRMFTYIUHNPQQY-UHFFFAOYSA-N

The toxicity data is as follows: