The Propanoic acid,3-chloro-, methyl ester, with CAS registry number 6001-87-2, has the systematic name of methyl 3-chloropropanoate. Besides this, it is also called 3-Chloropropionic acid methyl ester. And the chemical formula of this chemical is C₄H₇ClO₂. What's more, its EINECS is 227-844-4.

Physical properties of Propanoic acid,3-chloro-, methyl ester: (1)ACD/LogP: 0.78; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.78; (4)ACD/LogD (pH 7.4): 0.78; (5)#H bond acceptors: 2; (6)#H bond donors: 0; (7)#Freely Rotating Bonds: 3; (8)Polar Surface Area: 26.3 Å²; (9)Index of Refraction: 1.411; (10)Molar Refractivity: 27.2 cm³; (11)Molar Volume: 109.4 cm³; (12)Polarizability: 10.78×10^-24cm³; (13)Surface Tension: 29.2 dyne/cm; (14)Density: 1.119 g/cm³; (15)Flash Point: 40.5 °C; (16)Enthalpy of Vaporization: 39.27 kJ/mol; (17)Boiling Point: 156 °C at 760 mmHg; (18)Vapour Pressure: 2.95 mmHg at 25°C.

Preparation: this chemical can be prepared by methanol and β-Chlorproπonsaeurevinylester. This reaction will need reagent p-TsOH. The reaction time is 8 hour(s). The yield is about 86%.

You can still convert the following datas into molecular structure:
(1)SMILES: ClCCC(=O)OC
(2)InChI: InChI=1/C4H7ClO2/c1-7-4(6)2-3-5/h2-3H2,1H3
(3)InChIKey: GZGJIACHBCQSPC-UHFFFAOYAK
(4)Std. InChI: InChI=1S/C4H7ClO2/c1-7-4(6)2-3-5/h2-3H2,1H3
(5)Std. InChIKey: GZGJIACHBCQSPC-UHFFFAOYSA-N

The toxicity data is as follows: