The CAS registry number of (NZ)-N-[[3,4-Bis(phenylmethoxy)phenyl]methylidene]hydroxylamine is 31123-05-4. This chemical's molecular formula is C₂₁H₁₉NO₃ and molecular weight is 333.3805. Its systematic name is called 3,4-bis(benzyloxy)benzaldehyde oxime.

Physical properties of (NZ)-N-[[3,4-Bis(phenylmethoxy)phenyl]methylidene]hydroxylamine: (1)ACD/LogP: 5.34; (2)# of Rule of 5 Violations: 1; (3)ACD/LogD (pH 5.5): 5.34; (4)ACD/LogD (pH 7.4): 5.34; (5)ACD/BCF (pH 5.5): 6709.73; (6)ACD/BCF (pH 7.4): 6709.33; (7)ACD/KOC (pH 5.5): 19087.39; (8)ACD/KOC (pH 7.4): 19086.25; (9)#H bond acceptors: 4; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 8; (12)Index of Refraction: 1.569; (13)Molar Refractivity: 98.36 cm³; (14)Molar Volume: 300 cm³; (15)Surface Tension: 42.1 dyne/cm; (16)Density: 1.11 g/cm³; (17)Flash Point: 255.1 °C; (18)Enthalpy of Vaporization: 80.71 kJ/mol; (19)Boiling Point: 498.2 °C at 760 mmHg; (20)Vapour Pressure: 9.55E-11 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O(c2cc(ccc2OCc1ccccc1)/C=N\O)Cc3ccccc3
(2)InChI: InChI=1/C21H19NO3/c23-22-14-19-11-12-20(24-15-17-7-3-1-4-8-17)21(13-19)25-16-18-9-5-2-6-10-18/h1-14,23H,15-16H2/b22-14-
(3)InChIKey: BTTPSAYYBOVDKX-HMAPJEAMBB