The (R)-3-Morpholinecarboxylic acid, its cas register number is 106825-81-4. It also can be called as 3-Morpholinecarboxylicacid, (3R)- and the IUPAC name about this chemical is (3R)-morpholine-3-carboxylic acid. It belongs to the following product categories, such as carboxylicacid, pharmacetical and so on.

Physical properties about (R)-3-Morpholinecarboxylic acid are: (1)#H bond acceptors: 4; (2)#H bond donors: 2; (3)#Freely Rotating Bonds: 1; (4)Polar Surface Area: 58.56Ų; (5)Index of Refraction: 1.469; (6)Molar Refractivity: 29.5 cm³; (7)Molar Volume: 105.7 cm³; (8)Polarizability: 11.69x10^-24cm³; (9)Surface Tension: 42 dyne/cm; (10)Enthalpy of Vaporization: 59.23 kJ/mol; (11)Vapour Pressure: 0.0003 mmHg at 25°C

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1COCC(N1)C(=O)O
(2)Isomeric SMILES: C1COC[C@@H](N1)C(=O)O
(3)InChI: InChI=1S/C5H9NO3/c7-5(8)4-3-9-2-1-6-4/h4,6H,1-3H2,(H,7,8)/t4-/m1/s1
(4)InChIKey: JUNOWSHJELIDQP-SCSAIBSYSA-N