The 1,3-benzoxazole-6-carboxylic Acid, with the CAS registry number 154235-77-5, is also known as Benzo[d]oxazole-6-carboxylic acid. This chemical's molecular formula is C₈H₅NO₃ and molecular weight is 163.1302. Its IUPAC name is called 1,3-benzoxazole-6-carboxylic acid.

Physical properties of 1,3-benzoxazole-6-carboxylic Acid: (1)ACD/LogP: 0.97; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 3; (5)ACD/KOC (pH 7.4): 1; (6)#H bond acceptors: 4; (7)#H bond donors: 1; (8)#Freely Rotating Bonds: 1; (9)Index of Refraction: 1.661; (10)Molar Refractivity: 41.416 cm³; (11)Molar Volume: 112.097 cm³; (12)Surface Tension: 67.546 dyne/cm; (13)Density: 1.455 g/cm³; (14)Flash Point: 165.531 °C; (15)Enthalpy of Vaporization: 62.753 kJ/mol; (16)Boiling Point: 350.094 °C at 760 mmHg; (17)Vapour Pressure: 0 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: OC(=O)c1ccc2ncoc2c1
(2)InChI: InChI=1/C8H5NO3/c10-8(11)5-1-2-6-7(3-5)12-4-9-6/h1-4H,(H,10,11)
(3)InChIKey: FRNTUFQKHQMLSE-UHFFFAOYAO