The 1,5-Naphthalenedithiol, with the CAS registry number 5325-88-2, is also known as 1,5-Dimercaptonaphthalene. This chemical's molecular formula is C₁₀H₈S₂ and molecular weight is 192.3005. What's more, both its IUPAC name and systematic name are the same which is called Naphthalene-1,5-dithiol.

Physical properties about this chemical are: (1)ACD/LogP: 4.05; (2)#of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3.94; (4)ACD/LogD (pH 7.4): 2.6; (5)ACD/BCF (pH 5.5): 541.88; (6)ACD/BCF (pH 7.4): 24.81; (7)ACD/KOC (pH 5.5): 2921.34; (8)ACD/KOC (pH 7.4): 133.75; (9)#H bond acceptors: 0; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 2; (12)Polar Surface Area: 50.6 Å²; (13)Index of Refraction: 1.747; (14)Molar Refractivity: 60.44 cm³; (15)Molar Volume: 148.7 cm³; (16)Surface Tension: 56.6 dyne/cm; (17)Density: 1.292 g/cm³; (18)Flash Point: 178.6 °C; (19)Enthalpy of Vaporization: 57.51 kJ/mol; (20)Boiling Point: 353.7 °C at 760 mmHg; (21)Vapour Pressure: 7.16E-05 mmHg at 25 °C; (22)Meiting Point: 121 °C.

Uses of 1,5-Naphthalenedithiol: it is used to produce other chemicals. For example, it is used to produce Naphthalene-1,5-diyldimercapto-di-acetic acid.

The reaction occurs with reagent Potassium hydroxide and solvents Ethanol, H₂O. The reaction time is 5 hours.The yield is 98%.

You can still convert the following datas into molecular structure:
(1) SMILES: Sc1cccc2c1cccc2S
(2) InChI: InChI=1/C10H8S2/c11-9-5-1-3-7-8(9)4-2-6-10(7)12/h1-6,11-12H
(3) InChIKey: AAPAGLBSROJFGM-UHFFFAOYAR