The 1-Naphthalenepropanamine, with the CAS registry number 24781-50-8, is also known as 3-(1-Naphthyl)propan-1-amine. This chemical's molecular formula is C₁₃H₁₅N and molecular weight is 185.2649. Its systematic name is called 3-naphthalen-1-ylpropan-1-amine.

Physical properties of 1-Naphthalenepropanamine: (1)ACD/LogP: 3.09; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 1; (5)ACD/KOC (pH 7.4): 3; (6)#H bond acceptors: 1; (7)#H bond donors: 2; (8)#Freely Rotating Bonds: 4; (9)Index of Refraction: 1.617; (10)Molar Refractivity: 61.813 cm³; (11)Molar Volume: 176.551 cm³; (12)Surface Tension: 44.706 dyne/cm; (13)Density: 1.049 g/cm³; (14)Flash Point: 159.425 °C; (15)Enthalpy of Vaporization: 57.133 kJ/mol; (16)Boiling Point: 328.899 °C at 760 mmHg; (17)Vapour Pressure: 0 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: c1cccc2cccc(c12)CCCN
(2)InChI: InChI=1/C13H15N/c14-10-4-8-12-7-3-6-11-5-1-2-9-13(11)12/h1-3,5-7,9H,4,8,10,14H2
(3)InChIKey: XSNSJJCXHBHYNS-UHFFFAOYAU