The 1H-Imidazole-1-ethanol,2-(8-heptadecen-1-yl)-4,5-dihydro-, with the CAS registry number 95-38-5, is also known as 1H-imidazole-1-ethanol, 2-[(8E)-8-heptadecen-1-yl]-4,5-dihydro-. Its EINECS registry number is 202-414-9. This chemical's molecular formula is C₂₂H₄₂N₂O and molecular weight is 350.5817. Its systematic name is called 2-{2-[(8E)-heptadec-8-en-1-yl]-4,5-dihydro-1H-imidazol-1-yl}ethanol.

Physical properties of 1H-Imidazole-1-ethanol,2-(8-heptadecen-1-yl)-4,5-dihydro-: (1)ACD/LogP: 8.02; (2)# of Rule of 5 Violations: 1; (3)#H bond acceptors: 3; (4)#H bond donors: 1; (5)#Freely Rotating Bonds: 18; (6)Index of Refraction: 1.501; (7)Molar Refractivity: 109.06 cm³; (8)Molar Volume: 370 cm³; (9)Surface Tension: 35.1 dyne/cm; (10)Density: 0.94 g/cm³; (11)Flash Point: 255.2 °C; (12)Enthalpy of Vaporization: 88.27 kJ/mol; (13)Boiling Point: 498.3 °C at 760 mmHg; (14)Vapour Pressure: 5.12E-12 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: OCCN1\C(=N/CC1)CCCCCCC/C=C/CCCCCCCC
(2)InChI: InChI=1/C22H42N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22-23-18-19-24(22)20-21-25/h9-10,25H,2-8,11-21H2,1H3/b10-9+
(3)InChIKey: WGTDLPBPQKAPMN-MDZDMXLPBG

The toxicity data is as follows: