The 1H-Indole-2,3-dione,1-(phenylmethyl)-, with the CAS registry number 1217-89-6, is also known as N-Benzylisatin. This chemical's molecular formula is C₁₅H₁₁NO₂ and molecular weight is 237.2533. Its IUPAC name is called 1-benzylindole-2,3-dione.

Physical properties of 1H-Indole-2,3-dione,1-(phenylmethyl)-: (1)ACD/LogP: 2.36; (2)#H bond acceptors: 3; (3)#Freely Rotating Bonds: 2; (4)Index of Refraction: 1.66; (5)Molar Refractivity: 66.8 cm³; (6)Molar Volume: 180.8 cm³; (7)Surface Tension: 59.8 dyne/cm; (8)Density: 1.311 g/cm³; (9)Flash Point: 195.9 °C; (10)Enthalpy of Vaporization: 67.01 kJ/mol; (11)Boiling Point: 416.8 °C at 760 mmHg; (12)Vapour Pressure: 3.72E-07 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=CC=C(C=C1)CN2C3=CC=CC=C3C(=O)C2=O
(2)InChI: InChI=1S/C15H11NO2/c17-14-12-8-4-5-9-13(12)16(15(14)18)10-11-6-2-1-3-7-11/h1-9H,10H2
(3)InChIKey: SIISFRLGYDVIRG-UHFFFAOYSA-N