The 1H-Pyrrole-2,5-dione,1-(2,4-dimethylphenyl)-, with the CAS registry number 1080-52-0, is also known as 2,4-Dimethylphenylmaleimide. This chemical's molecular formula is C₁₂H₁₁NO₂ and molecular weight is 201.2212. What's more, its systematic name is called 1-(2,4-Dimethylphenyl)-1H-pyrrole-2,5-dione.

Physical properties about this chemical are: (1)ACD/LogP: 2.01; (2)#of Rule of 5 Violations: 0; (3)#H bond acceptors: 3; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 1; (6)Polar Surface Area: 37.38 Å²; (7)Index of Refraction: 1.603; (8)Molar Refractivity: 55.97 cm³; (9)Molar Volume: 162.8 cm³; (10)Polarizability: 22.18×10^-24 cm³; (11)Surface Tension: 51 dyne/cm; (12)Density: 1.235 g/cm³; (13)Flash Point: 155 °C; (14)Enthalpy of Vaporization: 58.68 kJ/mol; (15)Boiling Point: 343 °C at 760 mmHg; (16)Vapour Pressure: 7.27E-05 mmHg at 25 °C.

Uses of 1H-Pyrrole-2,5-dione,1-(2,4-dimethylphenyl)-: it is used to produce other chemicals. For example, it is used to produce 3-Benzylamino-N-(2',4'-dimethylphenyl)succinimide.

The reaction needs solvent Benzene at ambient temperature react for 5 days. The yield is 92%.

You can still convert the following datas into molecular structure:
(1) SMILES: O=C2\C=C/C(=O)N2c1c(cc(cc1)C)C
(2) InChI: InChI=1/C12H11NO2/c1-8-3-4-10(9(2)7-8)13-11(14)5-6-12(13)15/h3-7H,1-2H3
(3) InChIKey: LWFUFCYGHRBLDH-UHFFFAOYAM