The 2'-Methoxy-[1,1'-biphenyl]-3-amine hydrochloride is C₁₃H₁₄ClNO. The systematic name of this chemical is 2'-methoxybiphenyl-3-amine hydrochloride. With the CAS registry number 96923-01-2, it is also named as [1,1'-Biphenyl]-3-amine, 2'-methoxy-, hydrochloride (1:1). The product's category is Amines and Anilines.

The other characteristics of 2'-Methoxy-[1,1'-biphenyl]-3-amine hydrochloride can be summarized as: (1)ACD/LogP: 2.08; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2.05; (4)ACD/LogD (pH 7.4): 2.08; (5)ACD/BCF (pH 5.5): 20.98; (6)ACD/BCF (pH 7.4): 22.45; (7)ACD/KOC (pH 5.5): 301.58; (8)ACD/KOC (pH 7.4): 322.63; (9)#H bond acceptors: 2; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 3; (12)Polar Surface Area: 12.47 Å²; (13)Flash Point: 166.3 °C; (14)Enthalpy of Vaporization: 58.39 kJ/mol; (15)Boiling Point: 340.3 °C at 760 mmHg; (16)Vapour Pressure: 8.66E-05 mmHg at 25°C.

People can use the following data to convert to the molecule structure. 
1. SMILES:Cl.O(c2ccccc2c1cccc(N)c1)C
2. InChI:InChI=1/C13H13NO.ClH/c1-15-13-8-3-2-7-12(13)10-5-4-6-11(14)9-10;/h2-9H,14H2,1H3;1H 
3. InChIKey:FHFFNNZYOZAIBL-UHFFFAOYAL
4. Std. InChI:InChI=1S/C13H13NO.ClH/c1-15-13-8-3-2-7-12(13)10-5-4-6-11(14)9-10;/h2-9H,14H2,1H3;1H 
5. Std. InChIKey:FHFFNNZYOZAIBL-UHFFFAOYSA-N