The 2(1H)-Pyridinethione,6-mercapto-, with the CAS registry number 23941-53-9, is also known as 6-Mercapto-1H-pyridine-2-thione. It belongs to the product categories of Thiol; Pyridines. Its EINECS registry number is 245-945-1. This chemical's molecular formula is C₅H₅NS₂ and molecular weight is 143.2299. Its IUPAC name is called 6-sulfanyl-1H-pyridine-2-thione.

Physical properties of 2(1H)-Pyridinethione,6-mercapto-: (1)ACD/LogP: 1.16; (2)ACD/LogD (pH 5.5): 1.15; (3)ACD/LogD (pH 7.4): 0.9; (4)ACD/BCF (pH 5.5): 4.42; (5)ACD/BCF (pH 7.4): 2.46; (6)ACD/KOC (pH 5.5): 100.48; (7)ACD/KOC (pH 7.4): 55.94; (8)#H bond acceptors: 1; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 1; (11)Index of Refraction: 1.704; (12)Molar Refractivity: 41.36 cm³; (13)Molar Volume: 106.5 cm³; (14)Surface Tension: 62.8 dyne/cm; (15)Density: 1.34 g/cm³; (16)Flash Point: 93.9 °C; (17)Enthalpy of Vaporization: 46.84 kJ/mol; (18)Boiling Point: 231.7 °C at 760 mmHg; (19)Vapour Pressure: 0.0614 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=CC(=S)NC(=C1)S
(2)InChI: InChI=1S/C5H5NS2/c7-4-2-1-3-5(8)6-4/h1-3H,(H2,6,7,8)
(3)InChIKey: QVEUMXILHQDFLT-UHFFFAOYSA-N