The 3-Nitro-5-methylimidazo[1,2-a]pyridine, with the CAS registry number 34165-08-7, is also known as NSC305204 and ZINC13207517. This chemical's molecular formula is C₈H₇N₃O₂ and molecular weight is 177.16. What's more, both its IUPAC name and systematic name are the same which is called 5-Methyl-3-nitroimidazo[1,2-a]pyridine.

Physical properties about this chemical are: (1)ACD/LogP: 1.70; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 5; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 1; (6)Polar Surface Area: 63.12 Å²; (7)Index of Refraction: 1.676; (8)Molar Refractivity: 46.79 cm³; (9)Molar Volume: 124.2 cm³; (10)Surface Tension: 59.6 dyne/cm; (11)Density: 1.42 g/cm³.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CC1=CC=CC2=NC=C(N12)[N+](=O)[O-]
(2)InChI: InChI=1S/C8H7N3O2/c1-6-3-2-4-7-9-5-8(10(6)7)11(12)13/h2-5H,1H3
(3)InChIKey: OGZKKWYLIWRTHQ-UHFFFAOYSA-N