The 4-(2-Pyridyl)aniline with CAS registry number of 18471-73-3 is also known as Benzenamine, 4-(2-pyridinyl)-. The IUPAC name is 4-Pyridin-2-ylaniline. It belongs to product categories of pharmacetical. In addition, the formula is C₁₁H₁₀N₂ and the molecular weight is 170.21.

Physical properties about 4-(2-Pyridyl)aniline are: (1)ACD/LogP: 1.42; (2)# of Rule of 5 Violations: 0 ; (3)#H bond acceptors: 2; (4)#H bond donors: 2; (5)#Freely Rotating Bonds: 2; (6)Polar Surface Area: 16.13 Å²; (7)Index of Refraction: 1.625; (8)Molar Refractivity: 53.17 cm³; (9)Molar Volume: 150.2 cm³; (10)Polarizability: 21.07×10^-24cm³; (11)Surface Tension: 50.5 dyne/cm; (12)Density: 1.133 g/cm³; (13)Flash Point: 175.1 °C; (14)Enthalpy of Vaporization: 56.47 kJ/mol; (15)Boiling Point: 322.8 °C at 760 mmHg; (16)Vapour Pressure: 0.000272 mmHg at 25°C.

You can still convert the following datas into molecular structure:
1. SMILES: n1ccccc1c2ccc(N)cc2
2. InChI: InChI=1/C11H10N2/c12-10-6-4-9(5-7-10)11-3-1-2-8-13-11/h1-8H,12H2
3. InChIKey: BXYRAPNURYRQSP-UHFFFAOYAB