The 4-Methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine, with the CAS registry number 92503-61-2, is also known as Thieno[3,2-c]pyridine, 4,5,6,7-tetrahydro-4-methyl-. This chemical's molecular formula is C₈H₁₁NS and molecular weight is 153.24. Its systematic name is called 4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine.

Physical properties of 4-Methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridine: (1)ACD/LogP: 1.58; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -1.46; (4)ACD/LogD (pH 7.4): -0.41; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 1.76; (9)#H bond acceptors: 1; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 0; (12)Index of Refraction: 1.545; (13)Molar Refractivity: 44.86 cm³; (14)Molar Volume: 141.7 cm³; (15)Surface Tension: 36.6 dyne/cm; (16)Density: 1.08 g/cm³; (17)Flash Point: 103.1 °C; (18)Enthalpy of Vaporization: 48.39 kJ/mol; (19)Boiling Point: 246.8 °C at 760 mmHg; (20)Vapour Pressure: 0.0266 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: s1c2c(cc1)C(NCC2)C
(2)InChI: InChI=1/C8H11NS/c1-6-7-3-5-10-8(7)2-4-9-6/h3,5-6,9H,2,4H2,1H3
(3)InChIKey: IKTLCKCXJUXCSP-UHFFFAOYAF