The 4-Pyridinecarboxaldehyde,2-(4-thiomorpholinyl)-, with the CAS registry number 898289-24-2, is also known as 2-(Thiomorpholin-4-yl)isonicotinaldehyde 97%. This chemical's molecular formula is C₁₀H₁₂N₂OS and molecular weight is 208.2801. Its systematic name is called 2-thiomorpholinopyridine-4-carbaldehyde.

Physical properties of 4-Pyridinecarboxaldehyde,2-(4-thiomorpholinyl)-: (1)ACD/LogP: 0.80; (2)ACD/LogD (pH 5.5): 0.09; (3)ACD/LogD (pH 7.4): 0.78; (4)#H bond acceptors: 3; (5)#Freely Rotating Bonds: 2; (6)Index of Refraction: 1.635; (7)Molar Refractivity: 59.46 cm³; (8)Molar Volume: 166 cm³; (9)Surface Tension: 56.7 dyne/cm; (10)Density: 1.254 g/cm³; (11)Flash Point: 206.6 °C; (12)Enthalpy of Vaporization: 67.15 kJ/mol; (13)Boiling Point: 418 °C at 760 mmHg; (14)Vapour Pressure: 3.4E-07 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: c1cnc(cc1C=O)N2CCSCC2
(2)InChI: InChI=1/C10H12N2OS/c13-8-9-1-2-11-10(7-9)12-3-5-14-6-4-12/h1-2,7-8H,3-6H2
(3)InChIKey: XESFZSHCANCGBY-UHFFFAOYAF