The 4-Pyridinecarboxylicacid, 2,6-dichloro-3-hydroxy-, with the CAS registry number 185422-96-2, is also known as 2,6-Dichloro-3-hydroxyisonicotinic acid. It belongs to the product category of Pyridines. This chemical's molecular formula is C₆H₃Cl₂NO₃ and molecular weight is 207.9989. Its systematic name is called 2,6-dichloro-3-hydroxypyridine-4-carboxylic acid.

Physical properties of 4-Pyridinecarboxylicacid, 2,6-dichloro-3-hydroxy-: (1)ACD/LogP: 3.84; (2)ACD/LogD (pH 5.5): 0.7; (3)ACD/LogD (pH 7.4): 0.69; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 2.09; (7)ACD/KOC (pH 7.4): 2.05; (8)#H bond acceptors: 4; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 2; (11)Index of Refraction: 1.651; (12)Molar Refractivity: 42.94 cm³; (13)Molar Volume: 117.5 cm³; (14)Surface Tension: 78.9 dyne/cm; (15)Density: 1.769 g/cm³; (16)Flash Point: 285.6 °C; (17)Enthalpy of Vaporization: 87.17 kJ/mol; (18)Boiling Point: 548.7 °C at 760 mmHg; (19)Vapour Pressure: 7.13E-13 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: Clc1nc(Cl)cc(C(=O)O)c1O
(2)InChI: InChI=1/C6H3Cl2NO3/c7-3-1-2(6(11)12)4(10)5(8)9-3/h1,10H,(H,11,12)
(3)InChIKey: LOQNBXJKGZGLCJ-UHFFFAOYAP