The 6-Benzofuranol, with the CAS registry number 13196-11-7, is also known as 6-Hydroxybenzofuran. This chemical's molecular formula is C₈H₆O₂ and molecular weight is 134.13204. Its systematic name is called 1-benzofuran-6-ol.

Physical properties of 6-Benzofuranol: (1)ACD/LogP: 1.93; (2)ACD/LogD (pH 5.5): 1.93; (3)ACD/LogD (pH 7.4): 1.93; (4)ACD/BCF (pH 5.5): 17.36; (5)ACD/BCF (pH 7.4): 17.09; (6)ACD/KOC (pH 5.5): 268.43; (7)ACD/KOC (pH 7.4): 264.32; (8)#H bond acceptors: 2; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 1; (11)Index of Refraction: 1.651; (12)Molar Refractivity: 38.27 cm³; (13)Molar Volume: 104.7 cm³; (14)Surface Tension: 51 dyne/cm; (15)Density: 1.28 g/cm³; (16)Flash Point: 20.7 °C; (17)Enthalpy of Vaporization: 36.38 kJ/mol; (18)Boiling Point: 110.7 °C at 760 mmHg; (19)Vapour Pressure: 20 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: Oc2ccc1c(occ1)c2
(2)InChI: InChI=1/C8H6O2/c9-7-2-1-6-3-4-10-8(6)5-7/h1-5,9H
(3)InChIKey: UVJMVWURCUYFFK-UHFFFAOYAZ