The 6-Bromo-2-methyl-2H-indazole with the CAS number 590417-95-1 is also called 2H-Indazole,6-bromo-2-methyl-. The IUPAC name is 6-bromo-2-methylindazole. Its molecular formula is C₈H₇BrN₂. This chemical belongs to the following product categories: (1)Indazole; (2)Organohalides.

The properties of the chemical are: (1)ACD/LogP: 2.80; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3; (4)ACD/LogD (pH 7.4): 3; (5)ACD/BCF (pH 5.5): 54; (6)ACD/BCF (pH 7.4): 54; (7)ACD/KOC (pH 5.5): 605; (8)ACD/KOC (pH 7.4): 605; (9)#H bond acceptors: 2; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 17.82 Å²; (13)Index of Refraction: 1.663; (14)Molar Refractivity: 48.694 cm³; (15)Molar Volume: 131.377 cm³; (16)Polarizability: 19.304×10^-24cm³; (17)Surface Tension: 46.756 dyne/cm; (18)Enthalpy of Vaporization: 54.209 kJ/mol; (19)Vapour Pressure: 0.001 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: Brc1ccc2cn(C)nc2c1
(2)InChI: InChI=1/C8H7BrN2/c1-11-5-6-2-3-7(9)4-8(6)10-11/h2-5H,1H3
(3)InChIKey: BVYFYDANLZQCPV-UHFFFAOYAK