The 6-Fluoro-5-methylpyridine-3-boronic acid with the cas number 904326-92-7 is also called Boronic acid,B-(6-fluoro-5-methyl-3-pyridinyl)-. Both the systematic name and IUPAC name are (6-fluoro-5-methylpyridin-3-yl)boronic acid. Its molecular formula is C₆H₇BFNO₂. This chemical belongs to the following product categories: (1)Boronic acid; (2)Organoborons; (3)Pyridine.

The properties of the chemical are: (1)ACD/LogP: 0.67; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.59; (4)ACD/BCF (pH 5.5): 1.6; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 46.32; (7)ACD/KOC (pH 7.4): 3.44; (8)#H bond acceptors: 3; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 3; (11)Polar Surface Area: 53.35 Å²; (12)Index of Refraction: 1.504; (13)Molar Refractivity: 35.82 cm³; (14)Molar Volume: 120.8 cm³; (15)Polarizability: 14.2×10^-24cm³; (16)Surface Tension: 44.8 dyne/cm; (17)Enthalpy of Vaporization: 60.83 kJ/mol; (18)Vapour Pressure: 5.41×10^-5 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: Cc1cc(cnc1F)B(O)O
(2)InChI: InChI=1/C6H7BFNO2/c1-4-2-5(7(10)11)3-9-6(4)8/h2-3,10-11H,1H3
(3)InChIKey: XCWIMBMPJGQNHG-UHFFFAOYAL