The 6-Hydroxynicotinoyl hydrazide, with the CAS registry number 134531-63-8, is also known as 6-Oxo-1,6-dihydropyridine-3-carboxylic acid hydrazide. It belongs to the product category of Amide. This chemical's molecular formula is C₆H₇N₃O₂ and molecular weight is 153.14. Its systematic name is called 6-oxo-1,6-dihydropyridine-3-carbohydrazide.

Physical properties of 6-Hydroxynicotinoyl hydrazide: (1)ACD/LogP: -0.98; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 3; (5)ACD/KOC (pH 7.4): 3; (6)#H bond acceptors: 5; (7)#H bond donors: 4; (8)#Freely Rotating Bonds: 2; (9)Polar Surface Area: 84.22 Å²; (10)Index of Refraction: 1.591; (11)Molar Refractivity: 37.443 cm³; (12)Molar Volume: 110.801 cm³; (13)Surface Tension: 60.303 dyne/cm; (14)Density: 1.382 g/cm³.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(/C1=C/NC(=O)/C=C1)NN
(2)InChI: InChI=1/C6H7N3O2/c7-9-6(11)4-1-2-5(10)8-3-4/h1-3H,7H2,(H,8,10)(H,9,11)
(3)InChIKey: CWZHFIGWRBBYJC-UHFFFAOYAQ