The Acetamide,2-chloro-N-p-sulfamoylbenzyl- (6CI), with the CAS registry number 101167-02-6, is also known as N-[4-(Aminosulfonyl)benzyl]-2-chloroacetamide. This chemical's molecular formula is C₉H₁₁ClN₂O₃S and molecular weight is 262.7132. Its IUPAC name is called 2-chloro-N-[(4-sulfamoylphenyl)methyl]acetamide. 

Physical properties of Acetamide,2-chloro-N-p-sulfamoylbenzyl- (6CI): (1)ACD/LogP: -0.88; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 7.96; (5)ACD/KOC (pH 7.4): 7.95; (6)#H bond acceptors: 5; (7)#H bond donors: 3; (8)#Freely Rotating Bonds: 4; (9)Index of Refraction: 1.581; (10)Molar Refractivity: 61.67 cm³; (11)Molar Volume: 185 cm³; (12)Surface Tension: 54.9 dyne/cm; (13)Density: 1.419 g/cm³.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=CC(=CC=C1CNC(=O)CCl)S(=O)(=O)N
(2)InChI: InChI=1S/C9H11ClN2O3S/c10-5-9(13)12-6-7-1-3-8(4-2-7)16(11,14)15/h1-4H,5-6H2,(H,12,13)(H2,11,14,15)
(3)InChIKey: LTZYLTKHHXTVBQ-UHFFFAOYSA-N