The Benzenamine,3,5-difluoro-N-(4-fluorophenyl)- has the CAS registry number 403-80-5. This chemical's molecular formula is C₁₂H₈F₃N and molecular weight is 223.19. What's more, its systematic name is 3,5-difluoro-N-(4-fluorophenyl)aniline.

Physical properties of Benzenamine,3,5-difluoro-N-(4-fluorophenyl)- are: (1)ACD/LogP: 4.43; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 1; (4)#H bond donors: 1; (5)#Freely Rotating Bonds: 2; (6)Polar Surface Area: 3.24 Å²; (7)Index of Refraction: 1.575; (8)Molar Refractivity: 55.6 cm³; (9)Molar Volume: 168.1 cm³; (10)Polarizability: 22.04×10^-24cm³; (11)Surface Tension: 39.7 dyne/cm; (12)Density: 1.327 g/cm³; (13)Flash Point: 113.1 °C; (14)Enthalpy of Vaporization: 50.12 kJ/mol; (15)Boiling Point: 263.4 °C at 760 mmHg; (16)Vapour Pressure: 0.0103 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: Fc1ccc(cc1)Nc2cc(F)cc(F)c2
(2)InChI: InChI=1S/C12H8F3N/c13-8-1-3-11(4-2-8)16-12-6-9(14)5-10(15)7-12/h1-7,16H
(3)InChIKey: GSHQTKAPMXVMJR-UHFFFAOYSA-N