The CAS registry number of Benzenesulfonicacid, 2-amino-3,5-dichloro- is 6406-21-9. This chemical is also named as 2,4-Dichloroaniline-6-sulfonic acid. In addition, its molecular formula is C₆H₅Cl₂NO₃S and molecular weight is 242.0798. Its systematic name and IUPAC name are the same which is called 2-amino-3,5-dichlorobenzenesulfonic acid.

Physical properties about Benzenesulfonicacid, 2-amino-3,5-dichloro- are: (1)ACD/LogP: 2.63; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 4; (8)#H bond donors: 3; (9)#Freely Rotating Bonds: 2; (10)Index of Refraction: 1.648; (11)Molar Refractivity: 50.37 cm³; (12)Molar Volume: 138.3 cm³; (13)Surface Tension: 71.5 dyne/cm; (14)Density: 1.749 g/cm³.

You can still convert the following datas into molecular structure:
(1)SMILES: Nc1c(cc(Cl)cc1Cl)S(O)(=O)=O
(2)InChI: InChI=1/C6H5Cl2NO3S/c7-3-1-4(8)6(9)5(2-3)13(10,11)12/h1-2H,9H2,(H,10,11,12)
(3)InChIKey: UUBOVWHMFBDDEN-UHFFFAOYAT