The Benzo(a)phenazine 12-oxide, with the CAS registry number 18636-87-8, is also known as Benzo[a]phenazin-12-ol. This chemical's molecular formula is C₁₆H₁₀N₂O and molecular weight is 246.26. Its IUPAC name is called 12-oxidobenzo[a]phenazin-12-ium.

Physical properties of Benzo(a)phenazine 12-oxide: (1)ACD/LogP: 1.48; (2)#H bond acceptors: 3; (3)Index of Refraction: 1.711; (4)Molar Refractivity: 73.94 cm³; (5)Molar Volume: 188.9 cm³; (6)Surface Tension: 54.1 dyne/cm; (7)Density: 1.3 g/cm³; (8)Flash Point: 255.6 °C; (9)Enthalpy of Vaporization: 73.81 kJ/mol; (10)Boiling Point: 498.9 °C at 760 mmHg; (11)Vapour Pressure: 1.34E-09 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=CC=C2C(=C1)C=CC3=NC4=CC=CC=C4[N+](=C32)[O-]
(2)InChI: InChI=1S/C16H10N2O/c19-18-15-8-4-3-7-13(15)17-14-10-9-11-5-1-2-6-12(11)16(14)18/h1-10H
(3)InChIKey: QOEUHFSHKLIUGS-UHFFFAOYSA-N