The Benzonitrile,3-hydroxy-4-nitro-, with the CAS registry number 18495-15-3, has the molecular formula C₇H₄N₂O₃. Its molecular weight is 164.1183. Its systematic name is called 3-hydroxy-4-nitrobenzonitrile.

Physical properties of Benzonitrile,3-hydroxy-4-nitro-: (1)ACD/LogP: 1.73; (2)ACD/LogD (pH 5.5): 1.38; (3)ACD/BCF (pH 5.5): 5.44; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 93.04; (6)ACD/KOC (pH 7.4): 2.24; (7)#H bond acceptors: 5; (8)#H bond donors: 1; (9)#Freely Rotating Bonds: 2; (10)Index of Refraction: 1.628; (11)Molar Refractivity: 38.88 cm³; (12)Molar Volume: 109.4 cm³; (13)Surface Tension: 78.1 dyne/cm; (14)Density: 1.49 g/cm³; (15)Flash Point: 143.5 °C; (16)Enthalpy of Vaporization: 57.68 kJ/mol; (17)Boiling Point: 313.6 °C at 760 mmHg; (18)Vapour Pressure: 0.000266 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=N(=O)c1ccc(cc1O)C#N
(2)InChI: InChI=1/C7H4N2O3/c8-4-5-1-2-6(9(11)12)7(10)3-5/h1-3,10H
(3)InChIKey: JHNIFYUIFUWEFO-UHFFFAOYAZ