The Benzonitrile,4-amino-2-methoxy- is an organic compound with the molecular formula C₈H₈N₂O. Its CAS registry number is 7251-09-4. The IUPAC name of this chemical is called 4-Amino-2-methoxybenzonitrile. What's more, the molecular weight of this chemical is 148.16192.

Physical properties about Benzonitrile,4-amino-2-methoxy- are: (1)ACD/LogP: 1.27; (2)#of Rule of 5 Violations: 0 ; (3)#H bond acceptors: 3; (4)#H bond donors: 2; (5)#Freely Rotating Bonds: 2; (6)Polar Surface Area: 36.26 Å²; (7)Index of Refraction: 1.569; (8)Molar Refractivity: 41.3 cm³; (9)Molar Volume: 125.9 cm³; (10)Polarizability: 16.37×10^-24 cm³; (11)Surface Tension: 52.8 dyne/cm; (12)Density: 1.17 g/cm³; (13)Flash Point: 166.2 °C; (14)Enthalpy of Vaporization: 59.59 kJ/mol; (15)Boiling Point: 351.2 °C at 760 mmHg; (16)Vapour Pressure: 4.18E-05 mmHg at 25 °C.

You can still convert the following datas into molecular structure:
(1) SMILES: N#Cc1ccc(cc1OC)N
(2) InChI: InChI=1/C8H8N2O/c1-11-8-4-7(10)3-2-6(8)5-9/h2-4H,10H2,1H3
(3) InChIKey: KTDRJLRJAHBQDQ-UHFFFAOYAR