The Benzothiazole,2-(4-fluorophenyl)- is an organic compound with the molecular formula C₁₃H₈FNS. Its CAS registry number is 1629-26-1. The IUPAC name of this chemical is called 2-(4-Fluorophenyl)-1,3-benzothiazole. What's more, the molecular weight of this chemical is 229.2727232.

Physical properties about Benzothiazole,2-(4-fluorophenyl)- are: (1)ACD/LogP: 4.48; (2)#of Rule of 5 Violations: 0 ; (3)#H bond acceptors: 1; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 1; (6)Polar Surface Area: 41.13 Å²; (7)Index of Refraction: 1.663; (8)Molar Refractivity: 65.15 cm³; (9)Molar Volume: 175.7 cm³; (10)Polarizability: 25.83×10^-24 cm³; (11)Surface Tension: 50.6 dyne/cm; (12)Density: 1.304 g/cm³; (13)Flash Point: 166.7 °C; (14)Enthalpy of Vaporization: 57.33 kJ/mol; (15)Boiling Point: 352.1 °C at 760 mmHg; (16)Vapour Pressure: 7.97E-05 mmHg at 25 °C.

You can still convert the following datas into molecular structure:
(1) SMILES: Fc3ccc(c1nc2ccccc2s1)cc3
(2) InChI: InChI=1/C13H8FNS/c14-10-7-5-9(6-8-10)13-15-11-3-1-2-4-12(11)16-13/h1-8H
(3) InChIKey: MWIDLEVLPMTJDU-UHFFFAOYAH